Dansyl amide

Dansyl amide is a fluorescent dye that forms in a reaction between dansyl chloride and ammonia. It is the simplest representative of the class of dansyl derivatized amines, which are widely used in biochemistry and chemistry as fluorescent labels.^[1] The dansyl amide moiety is also called a dansyl group, and it can be introduced into amino acids or other amines in a reaction with dansyl chloride.^[2] The dansyl group is highly fluorescent, and it has a very high Stokes shift. The excitation maximum (ca 350 nm) is essentially independent on the medium, whereas the emission maximum strongly depends on the solvent and varies from 520 to 550 nm.^[3]

Dansyl amide

Names
Preferred IUPAC name 5-(Dimethylamino)naphthalene-1-sulfonamide
Other names Dansyl amide
Identifiers
CAS Number	1431-39-6 Y
3D model (JSmol)	Interactive image
ChemSpider	58587 N
ECHA InfoCard	100.014.413
PubChem CID	65077
UNII	ZUZ5S5875E Y
CompTox Dashboard (EPA)	DTXSID70162306
InChI InChI=1S/C12H14N2O2S/c1-14(2)11-7-3-6-10-9(11)5-4-8-12(10)17(13,15)16/h3-8H,1-2H3,(H2,13,15,16) N Key: TYNBFJJKZPTRKS-UHFFFAOYSA-N N InChI=1/C12H14N2O2S/c1-14(2)11-7-3-6-10-9(11)5-4-8-12(10)17(13,15)16/h3-8H,1-2H3,(H2,13,15,16) Key: TYNBFJJKZPTRKS-UHFFFAOYAD
SMILES O=S(=O)(c1cccc2c1cccc2N(C)C)N
Properties
Chemical formula	C12H14N2O2S
Molar mass	250.31676
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). N verify (what is YN ?) Infobox references