Dehydrocorybulbine (DHCB) is an alkaloid isolated from Corydalis yanhusuo.[2] Dehydrocorybulbine binds to the dopamine D1 receptor.[2]
Quick facts Names, Identifiers ...
Dehydrocorybulbine
 |
| Names |
| IUPAC name
3-Hydroxy-2,9,10-trimethoxy-13-methyl-7,8,13,13a-tetradehydroberbin-7-ium |
Systematic IUPAC name
3-Hydroxy-2,9,10-trimethoxy-13-methyl-5,6-dihydro-7λ5-isoquinolino[3,2-a]isoquinolin-7-ylium |
| Identifiers |
|
|
|
|
| ChEMBL |
|
| ChemSpider |
|
|
|
|
|
InChI=1S/C21H21NO4/c1-12-14-5-6-18(24-2)21(26-4)16(14)11-22-8-7-13-9-17(23)19(25-3)10-15(13)20(12)22/h5-6,9-11H,7-8H2,1-4H3/p+1 Key: XWCVASCMRTXXRY-UHFFFAOYSA-O
|
O(c4cc3c2c(c1ccc(OC)c(OC)c1c[n+]2CCc3cc4O)C)C
|
| Properties |
|
C21H22NO4+ |
| Molar mass |
352.40 g/mol |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
Close
Research has indicated that DHCB can be helpful in reducing neuropathic pain.[3][4]