Derrubone is a prenylated isoflavone, a type of flavonoid. It was originally isolated from the Indian tree Derris robusta.[1] Recent research indicates that it acts as an inhibitor of Hsp90 to its function as a chaperone protein.[2]
Quick Facts Names, Identifiers ...
Derrubone
 |
| Names |
| IUPAC name
5,7-Dihydroxy-6-(3-methylbut-2-en-1-yl)-3′,4′-[methylenebis(oxy)]isoflavone |
Systematic IUPAC name
3-(2H-1,3-Benzodioxol-5-yl)-5,7-dihydroxy-6-(3-methylbut-2-en-1-yl)-4H-1-benzopyran-4-one |
| Other names
5,7-Dihydroxy-3',4'-methylenedioxy-6-prenylisoflavone |
| Identifiers |
|
|
|
|
| ChEMBL |
|
| ChemSpider |
|
|
|
| UNII |
|
|
|
InChI=1S/C21H18O6/c1-11(2)3-5-13-15(22)8-18-19(20(13)23)21(24)14(9-25-18)12-4-6-16-17(7-12)27-10-26-16/h3-4,6-9,22-23H,5,10H2,1-2H3 N Key: FTBGFGQPUMCUSC-UHFFFAOYSA-N N InChI=1/C21H18O6/c1-11(2)3-5-13-15(22)8-18-19(20(13)23)21(24)14(9-25-18)12-4-6-16-17(7-12)27-10-26-16/h3-4,6-9,22-23H,5,10H2,1-2H3 Key: FTBGFGQPUMCUSC-UHFFFAOYAI
|
CC(=CCC1=C(C=C2C(=C1O)C(=O)C(=CO2)C3=CC4=C(C=C3)OCO4)O)C
|
| Properties |
|
C21H18O6 |
| Molar mass |
366.369 g·mol−1 |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). |
Close
