Dichloroacetamide is a chlorinated derivative of acetamide.
Quick Facts Names, Identifiers ...
Dichloroacetamide[1]
 |
Names |
Preferred IUPAC name
|
Identifiers |
|
|
|
|
ChemSpider |
|
ECHA InfoCard |
100.010.614 |
EC Number |
|
|
|
UNII |
|
|
|
InChI=1S/C2H3Cl2NO/c3-1(4)2(5)6/h1H,(H2,5,6) Y Key: WCGGWVOVFQNRRS-UHFFFAOYSA-N Y InChI=1/C2H3Cl2NO/c3-1(4)2(5)6/h1H,(H2,5,6) Key: WCGGWVOVFQNRRS-UHFFFAOYAX
|
|
Properties |
|
C2H3Cl2NO |
Molar mass |
127.95732 |
Melting point |
98 to 100 °C (208 to 212 °F; 371 to 373 K) |
Boiling point |
233 to 234 °C (451 to 453 °F; 506 to 507 K) (745 mmHg) |
Hazards |
GHS labelling: |
|
 |
|
Warning |
|
H315, H319, H335 |
|
P261, P264, P271, P280, P302+P352, P304+P340, P305+P351+P338, P312, P321, P332+P313, P337+P313, P362, P403+P233, P405, P501 |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
Close