Dimethoxytrityl, often abbreviated DMT, is a protecting group widely used for protection of the 5'-hydroxy group in nucleosides, particularly in oligonucleotide synthesis.[1]
Quick Facts Names, Identifiers ...
Dimethoxytrityl
 |
Names |
IUPAC name
bis(4-methoxyphenyl)-phenylmethyl radical |
Other names
- 4,4'-Benzylidenedianisole
- 4,4'-Dimethoxytrityl cation
- 4,4'-Dimethoxytriphenylmethyl radical
- Bis(p-methoxyphenyl)phenylmethyl radical
- DMT
|
Identifiers |
|
|
|
|
ChemSpider |
|
EC Number |
|
|
|
UNII |
|
-H: InChI=1S/C21H20O2/c1-22-19-12-8-17(9-13-19)21(16-6-4-3-5-7-16)18-10-14-20(23-2)15-11-18/h3-15,21H,1-2H3 Key: RIRAVPPUGSNYOU-UHFFFAOYSA-N +: InChI=1S/C21H19O2/c1-22-19-12-8-17(9-13-19)21(16-6-4-3-5-7-16)18-10-14-20(23-2)15-11-18/h3-15H,1-2H3/q+1 Key: JLRBVXBVFZQEHA-UHFFFAOYSA-N
|
-H: COC1=CC=C(C=C1)C(C2=CC=CC=C2)C3=CC=C(C=C3)OC +: COC1=CC=C(C=C1)C(=C2C=CC(=[O+]C)C=C2)C3=CC=CC=C3
|
Properties |
|
C21H19O2 |
Molar mass |
303.4 |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
Close
It is usually bound to a molecule, but can exist as a stable cation in solution, where it appears bright orange.[2]