Dioctyl sebacate (also di(2-ethylhexyl) sebacate, commonly abbreviated as DOS, DEHS, and BEHS) is an organic compound which is the diester of sebacic acid and 2-ethylhexanol.
Quick facts Names, Identifiers ...
Dioctyl sebacate
 |
| Names |
| IUPAC name
Bis(2-ethylhexyl) decanedioate |
Systematic IUPAC name
[Heptane-3-yl-(-3-methane-1,1-diyl)-] decanedioate |
| Other names
Di(2-ethylhexyl) sebacate, Proviplast 1988, dioctyl sebacate (archaic) |
| Identifiers |
|
|
|
|
| ChemSpider |
|
| ECHA InfoCard |
100.004.145 |
|
|
| UNII |
|
|
|
InChI=1S/C26H50O4/c1-5-9-17-23(7-3)21-29-25(27)19-15-13-11-12-14-16-20-26(28)30-22-24(8-4)18-10-6-2/h23-24H,5-22H2,1-4H3 Y Key: VJHINFRRDQUWOJ-UHFFFAOYSA-N Y InChI=1/C26H50O4/c1-5-9-17-23(7-3)21-29-25(27)19-15-13-11-12-14-16-20-26(28)30-22-24(8-4)18-10-6-2/h23-24H,5-22H2,1-4H3 Key: VJHINFRRDQUWOJ-UHFFFAOYAA
|
CCCCC(CC)COC(=O)CCCCCCCCC(=O)OCC(CC)CCCC
|
| Properties |
|
C26H50O4 |
| Molar mass |
426.682 g·mol−1 |
| Density |
0.9 of water |
| Melting point |
−48 °C (−54 °F; 225 K) |
| Boiling point |
256 °C (493 °F; 529 K) at 0.7 kPa |
|
none |
| Vapor pressure |
0.000024 Pa at 37 °C |
| Hazards |
| Occupational safety and health (OHS/OSH): |
Main hazards |
reacts with oxidants |
| Flash point |
210 °C (410 °F; 483 K) open cup |
| Lethal dose or concentration (LD, LC): |
|
5 g/kg (rat, orally) |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). |
Close
It is an oily colorless liquid and is used as a plasticizer, including in the explosive C4.[1] It has also found use in Dot 5 brake fluid, in ester-based engine oils and additives, as seed particle for particle image velocimetry (PIV) and as a model compound that forms stable aerosols.
