Monopotassium glutamate (MPG) is the compound with formula KC5H8NO4. It is a potassium salt of glutamic acid.
Quick facts Names, Identifiers ...
 
Monopotassium glutamate
 
|  | 
|  | 
| Names | 
| IUPAC name Potassium 2-amino-5-hydroxy-5-oxopentanoate | 
| Other names Potassium glutamateE622Glutamic acid potassium salt
 | 
| Identifiers | 
|  |  | 
|  |  | 
| ChemSpider |  | 
| ECHA InfoCard | 100.039.161 | 
| E number | E622 (flavour enhancer) | 
|  |  | 
| UNII |  | 
|  |  | 
| 
InChI=1S/C5H9NO4.K/c6-3(5(9)10)1-2-4(7)8;/h3H,1-2,6H2,(H,7,8)(H,9,10);/q;+1/p-1 Y Key: HQEROMHPIOLGCB-UHFFFAOYSA-M YInChI=1/C5H9NO4.K/c6-3(5(9)10)1-2-4(7)8;/h3H,1-2,6H2,(H,7,8)(H,9,10);/q;+1/p-1 Key: HQEROMHPIOLGCB-REWHXWOFAL
 | 
| 
[K+].O=C([O-])C(N)CCC(=O)O
 | 
| Properties | 
|  | C5H8KNO4 | 
| Molar mass | 185.220 g·mol−1 | 
| Except where otherwise noted, data are given for materials in their standard state  (at 25 °C [77 °F], 100 kPa). | 
Close
It has the E number E622 and is used in foods as a flavor enhancer.  It is a non-sodium MSG alternative.