Engeletin is a flavanonol rhamnoside, a phenolic compound found in wine[1] and isolated from the bark of Hymenaea martiana.[2]
Quick facts Names, Identifiers ...
Engeletin
Chemical structure of engeletin |
Names |
IUPAC name
(2R,3R)-4′,5,7-Trihydroxy-3-(α-L-rhamnopyranosyloxy)flavan-4-one |
Preferred IUPAC name
(2R,3R)-5,7-Dihydroxy-2-(4-hydroxyphenyl)-3-{[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxy}-4H-1-benzopyran-4-one |
Other names
|
Identifiers |
|
|
|
|
|
|
|
|
InChI=1S/C21H22O10/c1-8-15(25)17(27)18(28)21(29-8)31-20-16(26)14-12(24)6-11(23)7-13(14)30-19(20)9-2-4-10(22)5-3-9/h2-8,15,17-25,27-28H,1H3/t8-,15-,17+,18+,19+,20-,21-/m0/s1 Key: VQUPQWGKORWZII-WDPYGAQVSA-N
|
CC1C(C(C(C(O1)OC2C(OC3=CC(=CC(=C3C2=O)O)O)C4=CC=C(C=C4)O)O)O)O
|
Properties |
|
C21H22O10 |
Molar mass |
434.397 g·mol−1 |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
Close