Epanorin is a lichen secondary metabolite with the molecular formula C25H25NO6.[2] Epanorin inhibits the proliferation of MCF-7 cancer cells.[2]
Quick facts Names, Identifiers ...
Epanorin
 |
| Names |
| IUPAC name
(1R,2R,13S,15R,16R,23R)-7,9,21-triazahexacyclo[11.9.1.11,15.02,7.09,23.016,21]tetracosane |
| Other names
CHEBI:144243 |
| Identifiers |
|
|
|
|
| ChEBI |
|
|
|
InChI=1S/C25H25NO6/c1-15(2)14-18(24(29)31-3)26-23(28)20(17-12-8-5-9-13-17)22-21(27)19(25(30)32-22)16-10-6-4-7-11-16/h4-13,15,18,27H,14H2,1-3H3,(H,26,28)/b22-20-/t18-/m0/s1 Key: IBSRGCBHIASQMQ-BKBKCADHSA-N
|
CC(C)C[C@@H](C(=O)OC)NC(=O)C(=C1C(=C(C(=O)O1)C2=CC=CC=C2)O)C3=CC=CC=C3
|
| Properties |
|
C25H25NO6 |
| Molar mass |
435.476 g·mol−1 |
| Melting point |
162–163 °C (324–325 °F; 435–436 K)[1] |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
Close