Estrane is a C18 steroid derivative, with a gonane core.
Quick Facts Names, Identifiers ...
Estrane
Stereo structural formula of estrane ((1R,2S,10R,11S,15S)-15-methyl,heptadec) |
Names |
IUPAC name
|
Systematic IUPAC name
(3aS,3bR,5aΞ,9aS,9bR,11aS)-11a-Methylhexadecahydro-1H-cyclopenta[a]phenanthrene |
Identifiers |
|
|
|
|
|
3125721 |
ChEBI |
|
ChemSpider |
- 11179505 Y
- 4574149 (1R,2S,10R,11S,15S)-15-methyl,heptadec Y
- 5256802 (1R,2S,7R,10R,11S,15S)-15-methyl,heptadec Y
- 5256794 (1R,2S,7S,10R,11S,15S)-15-methyl,heptadec Y
|
|
- 12313694
- 5460658 (1R,2S,10R,11S,15S)-15-methyl,heptadec
- 6857465 (1R,2S,7R,10R,11S,15S)-15-methyl,heptadec
- 6857457 (1R,2S,7S,10R,11S,15S)-15-methyl,heptadec
|
|
|
InChI=1S/C18H30/c1-18-11-4-7-17(18)16-9-8-13-5-2-3-6-14(13)15(16)10-12-18/h13-17H,2-12H2,1H3 Y Key: GRXPVLPQNMUNNX-UHFFFAOYSA-N Y
|
CC12CCCC1C1CCC3CCCCC3C1CC2
|
Properties |
|
C18H30 |
Molar mass |
246.438 g·mol−1 |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
Close
Estrenes are estrane derivatives that contain a double bond, with an example being nandrolone.[2] Estratrienes (estrins) are estrane derivatives that contain three double bonds, for instance estrin (estra-1,3,5(10)-triene). A class of female sex hormones, estrogens, such as estradiol, estrone, and estriol are estratrienes.