Ethyl isovalerate is an organic compound that is the ester formed from ethyl alcohol and isovaleric acid. It has a fruity odor[1] and flavor[2] and is used in perfumery and as a food additive.
Quick facts Names, Identifiers ...
Ethyl isovalerate
 |
| Names |
| Preferred IUPAC name
|
| Other names
Butanoic acid, 3-methyl-, ethyl ester |
| Identifiers |
|
|
|
|
| ChemSpider |
|
| ECHA InfoCard |
100.003.276 |
|
|
| UNII |
|
|
|
InChI=1S/C7H14O2/c1-4-9-7(8)5-6(2)3/h6H,4-5H2,1-3H3 Key: PPXUHEORWJQRHJ-UHFFFAOYSA-N InChI=1/C7H14O2/c1-4-9-7(8)5-6(2)3/h6H,4-5H2,1-3H3 Key: PPXUHEORWJQRHJ-UHFFFAOYAE
|
|
| Properties |
|
C7H14O2 |
| Molar mass |
130.187 g·mol−1 |
| Odor |
Fruity |
| Density |
0,8565 g/cm3 |
| Melting point |
−99.3 °C (−146.7 °F; 173.8 K) |
| Boiling point |
134.7 °C (274.5 °F; 407.8 K) |
|
−91.1·10−6 cm3/mol |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). |
Close
