Euphane is a tetracyclic triterpene that is the 13α,14β-stereoisomer of lanostane. Its derivatives are widely distributed in many plants.[2][3]
Quick facts Names, Identifiers ...
Euphane
 |
| Names |
| IUPAC name
13α,14β-Lanostane |
Systematic IUPAC name
(1S,3aR,3bR,5aS,9aR,9bS,11aS)-3a,6,6,9a,11a-Pentamethyl-1-[(2R)-6-methylheptan-2-yl]hexadecahydro-1H-cyclopenta[a]phenanthrene |
| Identifiers |
|
|
|
|
| ChemSpider |
|
|
|
|
|
InChI=1S/C30H54/c1-21(2)11-9-12-22(3)23-15-19-30(8)25-13-14-26-27(4,5)17-10-18-28(26,6)24(25)16-20-29(23,30)7/h21-26H,9-20H2,1-8H3/t22-,23+,24+,25-,26+,28-,29+,30-/m1/s1 Key: ZQIOPEXWVBIZAV-RRKMEGOCSA-N
|
C[C@H](CCCC(C)C)[C@@H]1CC[C@]2([C@]1(CC[C@H]3[C@H]2CC[C@@H]4[C@@]3(CCCC4(C)C)C)C)C
|
| Properties |
|
C30H54 |
| Molar mass |
414.762 g·mol−1 |
| Density |
0.897 g/cm3[1] |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). |
Close
