Ferujol is a compound in the coumarin family, isolated from Ferula jaeschkeana.
Quick facts Names, Identifiers ...
Ferujol
 |
| Names |
Preferred IUPAC name
8-{[(2E)-3,7-Dimethyloct-2-en-1-yl]oxy}-7-hydroxy-2H-1-benzopyran-2-one |
| Identifiers |
|
|
|
|
| ChemSpider |
|
|
|
| UNII |
|
|
|
InChI=1S/C19H24O4/c1-13(2)5-4-6-14(3)11-12-22-19-16(20)9-7-15-8-10-17(21)23-18(15)19/h7-11,13,20H,4-6,12H2,1-3H3/b14-11+ Y Key: ATKUFZHTQAERBN-SDNWHVSQSA-N Y InChI=1/C19H24O4/c1-13(2)5-4-6-14(3)11-12-22-19-16(20)9-7-15-8-10-17(21)23-18(15)19/h7-11,13,20H,4-6,12H2,1-3H3/b14-11+ Key: ATKUFZHTQAERBN-SDNWHVSQBS
|
O=C/2Oc1c(OC\C=C(/C)CCCC(C)C)c(O)ccc1\C=C\2
|
| Properties |
|
C19H24O4 |
| Molar mass |
316.397 g·mol−1 |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
Close
It is reported to have contraceptive activity when given to female rats 1–5 days after coitus.[1]