Fluoroacetamide is an organic compound with the chemical formula FCH2CONH2. It is a compound based on acetamide with one fluorine atom replacing hydrogen on the methyl group. It is very toxic.[1] It is a metabolic poison which disrupts the citric acid cycle and was used as a rodenticide.[2] May cause reproductive disorders. If swallowed or in contact with skin, it can cause serious damage and death. Can cause serious eye damage.[1]
Quick Facts Names, Identifiers ...
Fluoroacetamide
 Skeletal formula of fluoroacetamide |
 Ball-and-stick model of fluoroacetamide |
| Names |
| IUPAC name
2-Fluoroacetamide |
| Identifiers |
|
|
|
|
| ChEBI |
|
| ChEMBL |
|
| ChemSpider |
|
| ECHA InfoCard |
100.010.331 |
| KEGG |
|
|
|
| UNII |
|
|
|
InChI=1S/C2H4FNO/c3-1-2(4)5/h1H2,(H2,4,5) Y Key: FVTWJXMFYOXOKK-UHFFFAOYSA-N Y InChI=1/C2H4FNO/c3-1-2(4)5/h1H2,(H2,4,5) Key: FVTWJXMFYOXOKK-UHFFFAOYAA
|
|
| Properties |
|
FCH2CONH2 |
| Molar mass |
77.058 g·mol−1 |
| Appearance |
Colorless crystals |
| Melting point |
107 to 109 °C (225 to 228 °F; 380 to 382 K) |
|
Soluble |
| Hazards |
| Occupational safety and health (OHS/OSH): |
Main hazards |
Very toxic |
| GHS labelling: |
|
 |
|
Danger |
|
H300+H310 |
|
P262, P264, P270, P280, P301+P310+P330, P302, P350, P362, P405, P501 |
| NFPA 704 (fire diamond) |
|
| Lethal dose or concentration (LD, LC): |
|
80 mg/kg (dermal, rat) |
|
550 mg/m3(mouse, inhalation, dust/mist) |
| Safety data sheet (SDS) |
[1] |
| Related compounds |
Related compounds |
|
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). |
Close
