Gallacetophenone is the acetyl derivative of pyrogallol. It can be synthesized from pyrogallol using zinc chloride and acetic anhydride.[1]
Quick Facts Names, Identifiers ...
Gallacetophenone
 |
| Names |
Preferred IUPAC name
1-(2,3,4-Trihydroxyphenyl)ethan-1-one |
| Other names
1-(2,3,4-Trihydroxyphenyl)ethanone
Alizarin Yellow C
Galloacetophenone
2',3',4'-Trihydroxyacetophenone |
| Identifiers |
|
|
|
|
| ChemSpider |
|
| ECHA InfoCard |
100.007.665 |
|
|
| UNII |
|
|
|
InChI=1S/C8H8O4/c1-4(9)5-2-3-6(10)8(12)7(5)11/h2-3,10-12H,1H3 N Key: XIROXSOOOAZHLL-UHFFFAOYSA-N N InChI=1/C8H8O4/c1-4(9)5-2-3-6(10)8(12)7(5)11/h2-3,10-12H,1H3 Key: XIROXSOOOAZHLL-UHFFFAOYAA
|
|
| Properties |
|
C8H8O4 |
| Molar mass |
168.148 g·mol−1 |
| Melting point |
171 to 172 °C (340 to 342 °F; 444 to 445 K) |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). |
Close
