Gregatin B

Gregatin B is a metabolite of the fungi Cephalosporium gregatum and Aspergillus panamensis with the molecular formula C₁₄H₁₈O₄^[2][3] Gregatin B is a weak antibiotic.^[4][3] Gregatin B was discovered in 1982^[3] and has been the subject of total synthesis.^[5][6]

Gregatin B

Names
IUPAC name Methyl (5R)-5-[(1E,3E)-hexa-1,3-dienyl]-2,5-dimethyl-4-oxofuran-3-carboxylate[1]
Identifiers
CAS Number	58801-71-1 Y
3D model (JSmol)	Interactive image
ChemSpider	28288843
PubChem CID	53304446
InChI InChI=1S/C14H18O4/c1-5-6-7-8-9-14(3)12(15)11(10(2)18-14)13(16)17-4/h6-9H,5H2,1-4H3/b7-6+,9-8+/t14-/m1/s1 Key: BNZPIQOOHVBONM-PAMVGZKNSA-N
SMILES CC/C=C/C=C/[C@@]1(C(=O)C(=C(O1)C)C(=O)OC)C
Properties
Chemical formula	C14H18O4
Molar mass	250.294 g·mol−1
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). Infobox references