HPTE, also known as hydroxychlor, p,p'-hydroxy-DDT, or 2,2-bis(4-hydroxyphenyl)-1,1,1-trichloroethane, is a metabolite of methoxychlor, a synthetic insecticide related to DDT.[1] Like bisphenol A with similar chemical structure, HPTE is an endocrine disruptor which has estrogenic activity,[2] and also inhibits Cholesterol side-chain cleavage enzyme (P450scc, CYP11A1)[3] and 3α-hydroxysteroid dehydrogenase (3α-HSD).[4]
Quick facts Names, Identifiers ...
HPTE
 |
| Names |
Preferred IUPAC name
4,4′-(2,2,2-Trichloroethane-1,1-diyl)diphenol |
| Other names
p,p'-Hydroxy-DDT Hydroxychlor 2,2-bis(p-hydroxyphenyl)-1,1,1-trichloroethane 1,1,1-Trichloro-2,2-bis(4-hydroxyphenyl)ethane |
| Identifiers |
|
|
|
|
|
2054671 |
| ChEBI |
|
| ChEMBL |
|
| ChemSpider |
|
| ECHA InfoCard |
100.152.496 |
| EC Number |
|
| KEGG |
|
|
|
| UNII |
|
|
|
InChI=1S/C14H11Cl3O2/c15-14(16,17)13(9-1-5-11(18)6-2-9)10-3-7-12(19)8-4-10/h1-8,13,18-19H Key: IUGDILGOLSSKNE-UHFFFAOYSA-N InChI=1S/C14H11Cl3O2/c15-14(16,17)13(9-1-5-11(18)6-2-9)10-3-7-12(19)8-4-10/h1-8,13,18-19H Key: IUGDILGOLSSKNE-UHFFFAOYSA-N
|
C1=CC(=CC=C1C(C2=CC=C(C=C2)O)C(Cl)(Cl)Cl)O
|
| Properties |
|
C14H11Cl3O2 |
| Molar mass |
317.59 g·mol−1 |
| Hazards |
| GHS labelling: |
|
 |
|
Warning |
|
H315, H319, H335 |
|
P261, P264, P271, P280, P302+P352, P304+P340, P305+P351+P338, P312, P321, P332+P313, P337+P313, P362, P403+P233, P405, P501 |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
Close