Hamayne is an alkaloid present in plants of the family Amaryllidaceae, including Iberian Narcissus species and two Nigerian Crinum species, reported to have acetylcholinesterase inhibitory activity.[1] The product has been made via total synthesis as well.[2]
Quick facts Names, Identifiers ...
Hamayne
 |
| Names |
Systematic IUPAC name
(3α,11R,13β)-1,2-Didehydrocrinan-3,11-diol |
| Other names
Bulbispermine |
| Identifiers |
|
|
|
|
| ChEBI |
|
| ChEMBL |
|
| ChemSpider |
|
| KEGG |
|
|
|
|
|
InChI=1S/C16H17NO4/c18-10-1-2-16-11-5-13-12(20-8-21-13)3-9(11)6-17(7-15(16)19)14(16)4-10/h1-3,5,10,14-15,18-19H,4,6-8H2/t10-,14-,15-,16+/m0/s1 Key: KWAOMPWGIIXDPH-BLQKSXIESA-N InChI=1/C16H17NO4/c18-10-1-2-16-11-5-13-12(20-8-21-13)3-9(11)6-17(7-15(16)19)14(16)4-10/h1-3,5,10,14-15,18-19H,4,6-8H2/t10-,14-,15-,16+/m0/s1 Key: KWAOMPWGIIXDPH-BLQKSXIEBO
|
C1[C@H](C=C[C@@]23[C@H]1N(C[C@@H]2O)CC4=CC5=C(C=C34)OCO5)O
|
| Properties |
|
C16H17NO4 |
| Molar mass |
287.315 g·mol−1 |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
Close