Heptanoyl chloride is a seven-carbon acyl chloride with a straight-chain structure that is used as a reagent in organic synthesis.[1]
Quick Facts Names, Identifiers ...
Heptanoyl chloride
 |
Names |
Preferred IUPAC name
|
Other names
Enanthyl chloride; n-Heptanoyl chloride; Enanthic chloride; Oenanthic chloride |
Identifiers |
|
|
|
|
ChemSpider |
|
ECHA InfoCard |
100.017.978 |
EC Number |
|
|
|
UNII |
|
|
|
InChI=1S/C7H13ClO/c1-2-3-4-5-6-7(8)9/h2-6H2,1H3 Key: UCVODTZQZHMTPN-UHFFFAOYSA-N
|
|
Properties |
|
C7H13ClO |
Molar mass |
148.63 g·mol−1 |
Hazards |
GHS labelling: |
|
  |
|
Danger |
|
H290, H314, H330 |
|
P234, P260, P264, P264+P265, P271, P280, P284, P301+P330+P331, P302+P361+P354, P304+P340, P305+P354+P338, P316, P317, P320, P321, P363, P390, P403+P233, P405, P406, P501 |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
Close