Hexachloropropene

Hexachloropropene is a compound of chlorine and carbon with the linear formula CCl₃CCl=CCl₂.^[3] It is a colourless liquid at room temperature. It is toxic for humans.

Hexachloropropene

Names
Preferred IUPAC name 1,1,2,3,3,3-Hexachloroprop-1-ene
Identifiers
CAS Number	1888-71-7
3D model (JSmol)	Interactive image
ChemSpider	15113
ECHA InfoCard	100.015.965
EC Number	217-560-9
PubChem CID	15902
UNII	740VOV69VZ
UN number	3382 3082
CompTox Dashboard (EPA)	DTXSID7062039
InChI InChI=1S/C3Cl6/c4-1(2(5)6)3(7,8)9 Key: VFDYKPARTDCDCU-UHFFFAOYSA-N InChI=1/C3Cl6/c4-1(2(5)6)3(7,8)9 Key: VFDYKPARTDCDCU-UHFFFAOYAH
SMILES C(=C(Cl)Cl)(C(Cl)(Cl)Cl)Cl
Properties
Chemical formula	C3Cl6
Molar mass	248.75 g/mol
Appearance	colourless liquid[1]
Density	1.765 g/cm3 (at 25 °C)
Melting point	−73[1] °C (−99 °F; 200 K)
Boiling point	209–210[1] °C (408–410 °F; 482–483 K)
Solubility in water	0.25 g/L[1]
Solubility	soluble in carbon tetrachloride, ethanol and diethyl ether[2]
Hazards
GHS labelling:
Pictograms
Signal word	Danger
Hazard statements	H315, H319, H330, H332, H335
Precautionary statements	P260, P261, P264, P271, P280, P284, P302+P352, P304+P312, P304+P340, P305+P351+P338, P310, P312, P320, P321, P332+P313, P337+P313, P362, P403+P233, P405, P501
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). Infobox references

Hexachloropropene can be produced by the dehydrochlorination reaction of 1,1,1,2,2,3,3-heptachloropropane by potassium hydroxide in methanol solution.^[4] 1,1,1,2,2,3,3-Heptachloropropane is produced by the reaction of chloroform and tetrachloroethylene:

CHCl₃ + C₂Cl₄ → C₃HCl₇

C₃HCl₇ + KOH → C₃Cl₆ + KCl + H₂O

Hexachloropropene can be used to produce other compounds such as uranium tetrachloride, anhydrous niobium pentachloride and tungsten hexachloride.^[5]