Indolizidine is a heterocyclic chemical compound that forms the central core of the indolizidine alkaloids such as swainsonine and castanospermine.
Quick facts Names, Identifiers ...
Indolizidine
 |
| Names |
| IUPAC name
Octahydroindolizine |
| Other names
δ-Coniceine; 1-Azabicyclo[4.3.0]nonane |
| Identifiers |
|
|
|
|
| ChemSpider |
|
| ECHA InfoCard |
100.033.716 |
|
|
| UNII |
|
|
|
InChI=1S/C8H15N/c1-2-6-9-7-3-5-8(9)4-1/h8H,1-7H2 Key: HAJKHJOABGFIGP-UHFFFAOYSA-N InChI=1/C8H15N/c1-2-6-9-7-3-5-8(9)4-1/h8H,1-7H2 Key: HAJKHJOABGFIGP-UHFFFAOYAG
|
|
| Properties |
|
C8H15N |
| Molar mass |
125.215 g·mol−1 |
| Density |
0.8956 g/cm3 (20 °C)[1] |
| Boiling point |
159 to 160 °C (318 to 320 °F; 432 to 433 K)[2] |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). |
Close
