Isopropylthioxanthone (ITX) is used as a photoinitiator in printing.[1][2]
Quick facts Names, Identifiers ...
Isopropylthioxanthone
 |
| Names |
Preferred IUPAC name
4-(Propan-2-yl)-9H-thioxanthen-9-one |
| Identifiers |
|
|
|
|
| ChemSpider |
|
| ECHA InfoCard |
100.073.674 |
| EC Number |
|
|
|
| UNII |
|
|
|
InChI=1S/C16H14OS/c1-10(2)11-7-5-8-13-15(17)12-6-3-4-9-14(12)18-16(11)13/h3-10H,1-2H3 Key: IKVYHNPVKUNCJM-UHFFFAOYSA-N InChI=1/C16H14OS/c1-10(2)11-7-5-8-13-15(17)12-6-3-4-9-14(12)18-16(11)13/h3-10H,1-2H3 Key: IKVYHNPVKUNCJM-UHFFFAOYAM
|
CC(C)C1=CC=CC2=C1SC3=CC=CC=C3C2=O
|
| Properties |
|
C16H14OS |
| Molar mass |
254.35 g·mol−1 |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
Close
In 2005, traces of isopropyl thioxanthone were found by Italian authorities in babies milk produced by Nestlé.[3]