Isorhapontin is a stilbenoid. It is the glucoside of isorhapontigenin. It can be found in mycorrhizal and non-mycorrhizal roots of Norway spruces (Picea abies),[1] in the bark of Picea sitchensis[2][3] or in white spruce (Picea glauca).[4]
Quick facts Names, Identifiers ...
Isorhapontin
Chemical structure of isorhapontin |
| Names |
| IUPAC name
3-Hydroxy-5-[(1E)-2-(4-hydroxy-3-methoxyphenyl)ethen-1-yl]phenoxy β-D-glucopyranoside |
Systematic IUPAC name
(2S,3R,4S,5S,6R)-2-{3-Hydroxy-5-[(1E)-2-(4-hydroxy-3-methoxyphenyl)ethen-1-yl]phenoxy}-6-(hydroxymethyl)oxane-3,4,5-triol |
| Other names
Isorhapontigenin glucoside |
| Identifiers |
|
|
|
|
| ChemSpider |
|
| ECHA InfoCard |
100.230.305 |
| KEGG |
|
|
|
| UNII |
|
|
|
InChI=1S/C21H24O9/c1-28-16-8-11(4-5-15(16)24)2-3-12-6-13(23)9-14(7-12)29-21-20(27)19(26)18(25)17(10-22)30-21/h2-9,17-27H,10H2,1H3/b3-2+/t17-,18-,19+,20-,21-/m1/s1 Key: KLPUXMNQDCUPNO-DXKBKAGUSA-N
|
COC1=C(C=CC(=C1)/C=C/C2=CC(=CC(=C2)O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O)O)O
|
| Properties |
|
C21H24O9 |
| Molar mass |
420.41 g/mol |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
Close