Lactamide is an amide derived from lactic acid. It is a white crystalline solid with a melting point of 73-76 °C.
Quick facts Names, Identifiers ...
Lactamide
 |
| Names |
| Preferred IUPAC name
|
| Other names
2-Hydroxypropionamide; Lactic acid amide; Lactic amide; α-Hydroxypropionamide |
| Identifiers |
|
|
|
|
| ChEBI |
|
| ChemSpider |
|
| ECHA InfoCard |
100.016.410 |
|
|
| UNII |
|
|
|
InChI=1S/C3H7NO2/c1-2(5)3(4)6/h2,5H,1H3,(H2,4,6) Key: SXQFCVDSOLSHOQ-UHFFFAOYSA-N InChI=1/C3H7NO2/c1-2(5)3(4)6/h2,5H,1H3,(H2,4,6) Key: SXQFCVDSOLSHOQ-UHFFFAOYAP
|
|
| Properties |
|
C3H7NO2 |
| Molar mass |
89.094 g·mol−1 |
| Melting point |
73 to 76 °C (163 to 169 °F; 346 to 349 K)[1] |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
Close
Lactamide can be prepared by the catalytic hydration of lactonitrile.[2]