Laminaribiose C12H22O11 is a disaccharide which is used notably in the agricultural field and as an antiseptic. It is in general obtained by hydrolysis or by acetolysis of natural polysaccharides of plant origin.[1] It is also a product of the caramelization of glucose.[2]
Quick facts Names, Identifiers ...
Laminaribiose
 |
| Names |
| IUPAC name
3-β-D-Glucopyranosyl-(1→3)-D-glucose |
Systematic IUPAC name
(2R,3S,4R,5R)-2,4,5,6-Tetrahydroxy-3-{[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}hexanal |
| Other names
3-β-D-Glucosyl-D-glucose |
| Identifiers |
|
|
|
|
| ChemSpider |
|
|
|
| UNII |
|
InChI=1S/C12H22O11/c13-1-3-5(15)7(17)8(18)12(22-3)23-10-6(16)4(2-14)21-11(20)9(10)19/h3-20H,1-2H2/t3-,4-,5-,6-,7+,8-,9-,10+,11?,12+/m1/s1 N Key: QIGJYVCQYDKYDW-LCOYTZNXSA-N N
|
O([C@H]1[C@H](O)[C@H](OC(O)[C@@H]1O)CO)[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O
|
| Properties |
|
C12H22O11 |
| Molar mass |
342.30 g/mol |
| Density |
1.768 g/mL |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). |
Close
