Linolein is a triglyceride in which glycerol is esterified with linoleic acid. It's a primary constituent of sunflower oil and multiple other vegetable fats. It is used in the manufacturing of biodiesel. Linolein is also an ingredient in some cosmetic products.
Quick Facts Names, Identifiers ...
Linolein[1]
 Linolein |
| Names |
| IUPAC name
Tri-O-[(9Z,12Z)-octadeca-9,12-dienoyl]glycerol |
Systematic IUPAC name
Propane-1,2,3-triyl tri[(9Z,12Z)-octadeca-9,12-dienoate] |
| Other names
Trilinolein; Glyceryl trilinoleate; Glycerol trilinoleate |
| Identifiers |
|
|
|
|
| ChemSpider |
|
| ECHA InfoCard |
100.007.880 |
|
|
| UNII |
|
|
|
InChI=1S/C57H98O6/c1-4-7-10-13-16-19-22-25-28-31-34-37-40-43-46-49-55(58)61-52-54(63-57(60)51-48-45-42-39-36-33-30-27-24-21-18-15-12-9-6-3)53-62-56(59)50-47-44-41-38-35-32-29-26-23-20-17-14-11-8-5-2/h16-21,25-30,54H,4-15,22-24,31-53H2,1-3H3/b19-16-,20-17-,21-18-,28-25-,29-26-,30-27- N Key: HBOQXIRUPVQLKX-BBWANDEASA-N N
|
CCCCC/C=C\C/C=C\CCCCCCCC(=O)OCC(OC(=O)CCCCCCC/C=C\C/C=C\CCCCC)COC(=O)CCCCCCC/C=C\C/C=C\CCCCC
|
| Properties |
|
C57H98O6 |
| Molar mass |
879.405 g·mol−1 |
| Density |
0.925 g/mL at 20 °C |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). |
Close
