Mafosfamide (INN; development code ASTA-Z-7557) is an oxazaphosphorine (cyclophosphamide-like) alkylating agent under investigation as a chemotherapeutic. It is metabolized by cytochrome P450 into 4-hydroxycyclophosphamide, which is then converted into aldophosphamide, which, in turn yields the cytotoxic metabolites phosphoramide mustard and acrolein.[1]
Quick facts Names, Identifiers ...
Mafosfamide
 |
 |
Names |
IUPAC name
2-{(2-[bis(2-chloroethyl)amino]-2-oxido-1,3,2-oxazaphosphinan-4-yl}thio)ethanesulfonic acid |
Other names
2-{[2-[bis(2-chloroethyl)amino]-2-oxo-1-oxa-3-aza-2λ5-phosphacyclohex-4-yl}sulfanyl]ethanesulfonic acid ASTA-Z-7557 |
Identifiers |
|
|
|
|
ChemSpider |
|
MeSH |
Mafosfamide |
|
|
UNII |
|
|
|
InChI=1S/C9H19Cl2N2O5PS2/c10-2-4-13(5-3-11)19(14)12-9(1-6-18-19)20-7-8-21(15,16)17/h9H,1-8H2,(H,12,14)(H,15,16,17)/t9-,19-/m1/s1 Y Key: PBUUPFTVAPUWDE-AYLIAGHASA-N Y InChI=1/C9H19Cl2N2O5PS2/c10-2-4-13(5-3-11)19(14)12-9(1-6-18-19)20-7-8-21(15,16)17/h9H,1-8H2,(H,12,14)(H,15,16,17)/t9-,19-/m1/s1 Key: PBUUPFTVAPUWDE-AYLIAGHABO
|
O=P1(N[C@@H](CCO1)SCCS(O)(=O)=O)N(CCCl)CCCl
|
Properties |
|
C9H19Cl2N2O5PS2 |
Molar mass |
401.25 g·mol−1 |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
Close
Several Phase I trials have been completed.[2][3]