Manzanate is a flavor ingredient which has a fruity apple smell and with aspects of cider and sweet pineapple.[1]
Quick Facts Names, Identifiers ...
Ethyl 2-methylpentanoate
 |
| Names |
| IUPAC name
Ethyl 2-methylpentanoate |
| Other names
Ethyl α-methylvalerate; Melon valerate |
| Identifiers |
|
|
|
|
| ChemSpider |
|
| ECHA InfoCard |
100.049.422 |
| EC Number |
|
|
|
| UNII |
|
|
|
InChI=1S/C8H16O2/c1-4-6-7(3)8(9)10-5-2/h7H,4-6H2,1-3H3 N Key: HZPKNSYIDSNZKW-UHFFFAOYSA-N N InChI=1/C8H16O2/c1-4-6-7(3)8(9)10-5-2/h7H,4-6H2,1-3H3 Key: HZPKNSYIDSNZKW-UHFFFAOYAS
|
|
| Properties |
|
C8H16O2 |
| Molar mass |
144.21 g/mol |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). |
Close
