Meciadanol is a synthetic O-methylated flavanol. It is the 3-O-methylation of catechin.
Quick facts Names, Identifiers ...
Meciadanol
Chemical structure of meciadanol |
| Names |
| IUPAC name
3-Methoxyflavan-3′,4′,5,7-tetrol |
Systematic IUPAC name
(2R,3S)-2-(3,4-Dihydroxyphenyl)-3-methoxy-3,4-dihydro-2H-1-benzopyran-5,7-diol |
| Other names
3-O-Methylcatechin Meciadanolum 3',4',5,7-Tetrahydroxy-3-methoxyflavan (2R,3S)-2-(3,4-Dihydroxyphenyl)-3-methoxy-5,7-chromandiol |
| Identifiers |
|
|
|
|
| ChemSpider |
|
| ECHA InfoCard |
100.059.719 |
|
|
| UNII |
|
|
|
InChI=1S/C16H16O6/c1-21-15-7-10-12(19)5-9(17)6-14(10)22-16(15)8-2-3-11(18)13(20)4-8/h2-6,15-20H,7H2,1H3/t15-,16+/m0/s1 N Key: PDHSAQOQVUXZGQ-JKSUJKDBSA-N N InChI=1/C16H16O6/c1-21-15-7-10-12(19)5-9(17)6-14(10)22-16(15)8-2-3-11(18)13(20)4-8/h2-6,15-20H,7H2,1H3/t15-,16+/m0/s1 Key: PDHSAQOQVUXZGQ-JKSUJKDBBQ
|
CO[C@H]1CC2=C(C=C(C=C2O[C@@H]1C3=CC(=C(C=C3)O)O)O)O
|
| Properties |
|
C16H16O6 |
| Molar mass |
304.298 g·mol−1 |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
Close
It inhibits histidine decarboxylase in rats.[1]