Megazol

Megazol (CL 64855) is a nitroimidazole based drug that cures some protozoan infections.

Megazol

Clinical data
ATC code	None
Identifiers
IUPAC name 5-(1-methyl-5-nitro-1H-imidazol-2-yl)-1,3,4-thiadiazol-2-amine
CAS Number	19622-55-0 Y
ChemSpider	27598
UNII	VQ8UH664ZJ
CompTox Dashboard (EPA)	DTXSID50173298
Chemical and physical data
Formula	C6H6N6O2S
Molar mass	226.21 g·mol−1
3D model (JSmol)	Interactive image
SMILES Cn1c(cnc1c2nnc(s2)N)[N+](=O)[O-]

A study of nitroimidazoles found the drug extremely effective against T. cruzi and T. brucei which cause Chagas disease and African sleeping sickness, respectively. The drug is considerably more effective than standard benznidazole therapy (for Chagas) which is considered the gold standard.^[1] This is despite that other nitroimidazoles proved ineffective against these pathogens.^{[citation needed]}