Menthyl acetate is a natural monoterpene which contributes to the smell and flavor of peppermint. It is the acetate ester of menthol. Menthyl acetate constitutes 3–5% of the volatile oil of mentha piperita, contributing to its smell and flavour.[2][3]
Quick facts Names, Identifiers ...
l-Menthyl acetate[1]
 |
| Names |
| IUPAC name
(1R,3R,4S)-p-Menthan-3-yl acetate |
Systematic IUPAC name
(1R,2S,5R)-5-Methyl-2-(propan-2-yl)cyclohexyl acetate |
Other names
(1 R)-(−)-Menthyl acetate
Ethanoic (1R,2S,5R)-2-isopropyl-5-methylcyclohexane-1-carboxylate
Acetic (1 R,2 S,5 R)-2-isopropyl-5-methylcyclohexane-1-carboxylate |
| Identifiers |
|
|
|
|
| ChemSpider |
|
| ECHA InfoCard |
100.018.252 |
|
|
| UNII |
|
|
|
InChI=1S/C12H22O2/c1-8(2)11-6-5-9(3)7-12(11)14-10(4)13/h8-9,11-12H,5-7H2,1-4H3/t9-,11+,12-/m1/s1 N Key: XHXUANMFYXWVNG-ADEWGFFLSA-N N InChI=1/C12H22O2/c1-8(2)11-6-5-9(3)7-12(11)14-10(4)13/h8-9,11-12H,5-7H2,1-4H3/t9-,11+,12-/m1/s1 Key: XHXUANMFYXWVNG-ADEWGFFLBI
|
C[C@@H]1CC[C@H]([C@@H](C1)OC(=O)C)C(C)C
|
| Properties |
|
C12H22O2 |
| Molar mass |
198.30 g/mol |
| Density |
0.92 g/mL |
| Boiling point |
229–230 °C (444–446 °F; 502–503 K) |
| Hazards |
| Flash point |
77 °C (171 °F; 350 K) |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). |
Close
