Menthyl anthranilate (meradimate) is a sunscreening agent. It is one of the 17 ingredients approved by the Food and Drug Administration for use in over-the-counter sunscreen products.[1][2][3]
Quick facts Names, Identifiers ...
Menthyl anthranilate
 |
| Names |
| IUPAC name
(1R,3R,4S)-p-Menthan-3-yl 2-aminobenzoate |
Systematic IUPAC name
(1R,2S,5R)-5-Methyl-2-(propan-2-yl)cyclohexyl 2-aminobenzoate |
| Other names
Meradimate; Menthyl-o-aminobenzoate; Anthranilic acid menthyl ester; Anthranilic acid p-menth-3-yl ester |
| Identifiers |
|
|
|
|
| ChemSpider |
|
| ECHA InfoCard |
100.004.664 |
|
|
| UNII |
|
|
|
InChI=1S/C17H25NO2/c1-11(2)13-9-8-12(3)10-16(13)20-17(19)14-6-4-5-7-15(14)18/h4-7,11-13,16H,8-10,18H2,1-3H3/t12-,13+,16-/m1/s1 Key: SOXAGEOHPCXXIO-DVOMOZLQSA-N InChI=1/C17H25NO2/c1-11(2)13-9-8-12(3)10-16(13)20-17(19)14-6-4-5-7-15(14)18/h4-7,11-13,16H,8-10,18H2,1-3H3/t12-,13+,16-/m1/s1 Key: SOXAGEOHPCXXIO-DVOMOZLQBB
|
O=C(O[C@H]1[C@@H](CC[C@H](C1)C)C(C)C)c2ccccc2N
|
| Properties |
|
C17H25NO2 |
| Molar mass |
275.392 g·mol−1 |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
Close