Morindin is an anthraquinone glycoside present in several Morinda species, especially M. tinctoria (the Indian mulberry tree) and M. citrifolia (noni). Chemical or enzymatic hydrolysis of morindin yields its bright red aglycone, morindone.[citation needed]
Quick facts Names, Identifiers ...
Morindin
 |
| Names |
| IUPAC name
1,5-Dihydroxy-2-methyl-6-[β-D-xylopyranosyl-(1→6)-β-D-glucopyranosyloxy]anthracene-9,10-dione |
Systematic IUPAC name
1,5-Dihydroxy-2-methyl-6-{{#parsoidfragment:0}}{[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-({[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxy}methyl)oxan-2-yl]oxy}anthracene-9,10-dione |
| Other names
Morindone 6-beta-primeveroside |
| Identifiers |
|
|
|
|
| ChemSpider |
|
|
|
| UNII |
|
|
|
InChI=1S/C26H28O14/c1-8-2-3-9-14(16(8)28)17(29)10-4-5-12(20(32)15(10)18(9)30)39-26-24(36)22(34)21(33)13(40-26)7-38-25-23(35)19(31)11(27)6-37-25/h2-5,11,13,19,21-28,31-36H,6-7H2,1H3/t11-,13-,19+,21-,22+,23-,24-,25+,26-/m1/s1 Key: UVLAQGRQOILFBG-UHCLWRNRSA-N
|
CC1=C(C2=C(C=C1)C(=O)C3=C(C2=O)C=CC(=C3O)OC4C(C(C(C(O4)COC5C(C(C(CO5)O)O)O)O)O)O)O
|
| Properties |
|
C26H28O14 |
| Molar mass |
564.5 g·mol−1 |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). |
Close
The structure and formula of morindin were first elucidated by Thomas Edward Thorpe and T. H. Greenall in 1887.[1][2]
