Naphthalocyanine is a cross-shaped organic molecule consisting of 48 carbon, 8 nitrogen and 26 hydrogen atoms. It is a derivative of phthalocyanine, differing by having 4 extra carbon rings, one on each "arm." IBM Research labs used it for developing single-molecule logic switches[1] and visualizing charge distribution in a single molecule.[2][3]
Quick facts Names, Identifiers ...
Naphthalocyanine
|
|
| Names |
| IUPAC name
21H,23H-Tetranaphtho[2′,3′:2,3;2′′,3′′:7,8;2′′′,3′′′:12,13;2′′′ ′,3′′′ ′:17,18]porphyrin |
Systematic IUPAC name
[11(2)Z,13(8)Z,33(4)Z,7(81)Z]-12H,52H-2,4,6,8-Tetraaza-1,3,5,7(1,3)-tetrakis(benzo[f]isoindola)cyclooctaphane-11(2),13(8),33(4),7(81)-tetraene |
| Other names
Tetrabenzo[g]quinoxalino-2,3-porphyrazine |
| Identifiers |
|
|
|
|
| ChemSpider |
|
|
|
|
|
InChI=1S/C48H26N8/c1-2-10-26-18-34-33(17-25(26)9-1)41-49-42(34)54-44-37-21-29-13-5-6-14-30(29)22-38(37)46(51-44)56-48-40-24-32-16-8-7-15-31(32)23-39(40)47(52-48)55-45-36-20-28-12-4-3-11-27(28)19-35(36)43(50-45)53-41/h1-24H,(H2,49,50,51,52,53,54,55,56) Y Key: LKKPNUDVOYAOBB-UHFFFAOYSA-N Y
|
C1(/N=C(C2=C/3C=C4C=CC=CC4=C2)\NC3=N/C(C5=C/6C=C(C=CC=C7)C7=C5)=NC6=N/8)=N/C(C9=CC%10=CC=CC=C%10C=C19)=N\C%11=C%12C=C%13C=CC=CC%13=CC%12=C8N%11
|
| Properties |
|
C48H26N8 |
| Molar mass |
714.792 g·mol−1 |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). |
Close
Naphthalocyanine derivatives have a potential use in photodynamic cancer treatment.[4]
