Nithiazine is a nitromethylene neonicotinoid insecticide. It is irritating to the eyes and skin, and is moderately toxic to mammals.[2]
Quick facts Names, Identifiers ...
Nithiazine
 |
Names |
IUPAC name
(E/Z)-2-Nitromethylene-1,3-thiazinane |
Identifiers |
|
|
|
|
ChEMBL |
|
ChemSpider |
|
ECHA InfoCard |
100.107.942 |
EC Number |
|
|
|
UNII |
|
|
|
InChI=1S/C5H8N2O2S/c8-7(9)4-5-6-2-1-3-10-5/h4,6H,1-3H2/b5-4-
|
|
Properties |
|
C5H8N2O2S |
Molar mass |
160.19 g·mol−1 |
Appearance |
Crystals or brown powder |
Density |
1.388 g/cm3 |
Hazards |
GHS labelling: |
|
 |
|
Warning |
|
H302, H312, H315, H319, H332, H335 |
|
P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P312, P304+P340, P305+P351+P338, P312, P321, P322, P330, P332+P313, P337+P313, P362, P363, P403+P233, P405, P501 |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
Close
Nithiazine does not act as an acetylcholinesterase inhibitor.[3]