Norpatchoulenol is a tricyclic terpenoid found in commercial patchouli extract in small quantities, and thought to contribute significantly to the aroma of patchouli oil.[1]
Quick facts Names, Identifiers ...
Norpatchoulenol
|
|
| Names |
| IUPAC name
8a,9,9-Trimethyl-1,2,4a,5,6,7,8,8a-octahydro-1,6-methanonaphthalen-1-ol |
| Identifiers |
|
|
|
|
| ChemSpider |
|
|
|
|
|
InChI=1S/C14H22O/c1-12(2)10-6-8-13(3)11(9-10)5-4-7-14(12,13)15/h4-5,10-11,15H,6-9H2,1-3H3/t10?,11?,13-,14?/m0/s1 Y Key: OSQSDJNIURJARY-QHNNHONCSA-N Y InChI=1/C14H22O/c1-12(2)10-6-8-13(3)11(9-10)5-4-7-14(12,13)15/h4-5,10-11,15H,6-9H2,1-3H3/t10?,11?,13-,14?/m0/s1 Key: OSQSDJNIURJARY-QHNNHONCBN
|
C[C@]31CCC2CC3/C=C\CC1(O)C2(C)C
|
| Properties |
|
C14H22O |
| Molar mass |
206.329 g·mol−1 |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). |
Close
