Oxathiapiprolin (trade names Orondis,[1] Zorvec, and Segovis) is a fungicide. In the United States, the Environmental Protection Agency has approved it for use against several plant diseases including downy mildew and various Phytophthora species[1] including late blight on crops including vegetables, ornamentals, and turf.[2]
Quick facts Names, Identifiers ...
Oxathiapiprolin
 |
| Names |
Preferred IUPAC name
12,16-Difluoro-75-methyl-73-(trifluoromethyl)-24,25-dihydro-4(4,1)-piperidina-2(5,3)-[1,2]oxazola-3(4,2)-[1,3]thiazola-7(1)-pyrazola-1(1)-benzenaheptaphan-5-one |
| Identifiers |
|
|
|
|
|
20731698 |
| ChEBI |
|
| ChemSpider |
|
| ECHA InfoCard |
100.227.885 |
| EC Number |
|
|
|
| UNII |
|
InChI=1S/C24H22F5N5O2S/c1-13-9-20(24(27,28)29)31-34(13)11-21(35)33-7-5-14(6-8-33)23-30-18(12-37-23)17-10-19(36-32-17)22-15(25)3-2-4-16(22)26/h2-4,9,12,14,19H,5-8,10-11H2,1H3 Key: IAQLCKZJGNTRDO-UHFFFAOYSA-N
|
CC1=CC(=NN1CC(=O)N2CCC(CC2)C3=NC(=CS3)C4=NOC(C4)C5=C(C=CC=C5F)F)C(F)(F)F
|
| Properties |
|
C24H22F5N5O2S |
| Molar mass |
539.53 g·mol−1 |
| Density |
1.4645 g/cm3 |
| Melting point |
146 to 148 °C (295 to 298 °F; 419 to 421 K) |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). |
Close
Its mechanism of action involves binding to the oxysterol-binding protein in Oomycetes.[3][4]
