Pachypodol is a chemical compound classified as an O-methylated flavonol. It can be isolated from a variety of plants including Calycopteris floribunda,[1] Pogostemon cablin,[2] and Croton ciliatoglanduliferus.[3]
Quick facts Names, Identifiers ...
Pachypodol
 Pachypodol structure |
 Pachypodol 3D structure |
| Names |
| IUPAC name
4′,5-Dihydroxy-3,3′,7-trimethoxyflavone |
Systematic IUPAC name
5-Hydroxy-2-(4-hydroxy-3-methoxyphenyl)-3,7-dimethoxy-4H-1-benzopyran-4-one |
| Other names
Quercetin 3,7,3'-trimethyl ether |
| Identifiers |
|
|
|
|
| ChEBI |
|
| ChemSpider |
|
| MeSH |
C008751 |
|
|
| UNII |
|
|
|
InChI=1S/C18H16O7/c1-22-10-7-12(20)15-14(8-10)25-17(18(24-3)16(15)21)9-4-5-11(19)13(6-9)23-2/h4-8,19-20H,1-3H3 N Key: KQFUXLQBMQGNRT-UHFFFAOYSA-N N InChI=1/C18H16O7/c1-22-10-7-12(20)15-14(8-10)25-17(18(24-3)16(15)21)9-4-5-11(19)13(6-9)23-2/h4-8,19-20H,1-3H3 Key: KQFUXLQBMQGNRT-UHFFFAOYAA
|
COC1=CC(=C2C(=C1)OC(=C(C2=O)OC)C3=CC(=C(C=C3)O)OC)O
|
| Properties |
|
C18H16O7 |
| Molar mass |
344.319 g·mol−1 |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). |
Close
