Phosphate phosphite

A phosphate phosphite is a chemical compound or salt that contains both phosphate and phosphite anions (PO3−4 and PO3−3). These are mixed anion compounds or mixed valence compounds. Some have third anions.

Phosphate phosphites frequently occur as metal organic framework (MOF) compounds which are of research interest for gas storage, detection or catalysis. In these phosphate and phosphite form bridging ligands to hard metal ions. Protonated amines are templates.^[1]

Naming

A phosphate phosphite compound may also be called a phosphite phosphate.

Production

Phosphate phosphite compounds are frequently produced by hydrothermal synthesis, in which a water solution of ingredients is enclosed in a sealed container and heated. Phosphate may be reduced to phosphite or phosphite oxidised to phosphate in this process.

Properties

On heating,

Related

Related to these are the nitrite nitrates and arsenate arsenites.

List

name	formula	ratio PO4:PO3	mw	system	space group	unit cell (Å)	volume	density	properties	references
1,4-Diammoniumbutane	[(H3N(CH2)4NH3)2][Sc5F4(HPO3)6(H2PO3)2(PO4)]	1:8	1300.8	monoclinic	C2/m	a = 12.888, b = 14.835, c = 10.531, β = 103.093°, Z = 2 (at 93 K)	1961.2			[2]
Imidazole	[C3N2H5]2[VIII 4(H2O)3(HPO3)4(HPO4)3]	3:4	1003.766	trigonal	P3c1	a = 13.499, c = 18.120, Z = 12	2280.35	2.143	green	[3]
	(C3H10NO)6[V8(H2O)6(PO4)2(HPO3)12]	2:12			P3c1	a = 13.5393, c = 18.2283	2893.8		green	[4]
	(C4H8N2)3[V8(H2O)6(PO4)2(HPO3)12]	2:12			P3c1	a = 13.4922, c = 18.3589	2894.3		green	[4]
	Mn5(μ-OH2)2(PO4)2(HPO3)2·2H2O	2:2								[5]
Iron(III) 2,2′-bipyridine phosphite−phposphate	[FeIII(2,2′-bipyridine)(HPO3)(H2PO4)]	1:1		monoclinic		a = 10.5407, b = 6.4298, c = 10.6172, β = 113.890°, Z = 2		1.878	colourless	[6]
	FeIII(1,10-phenanthroline)(HPO3)(H2PO3)	1:1		monoclinic	P21/m	a = 10.180, b = 6.424, c = 11.6668, β = 115.59°, Z = 4	668.2	1.880	yellow	[7]
	{[C3H4N2]2[C5NH5]14[H15(Mo2O4)8Co16(PO4)14(HPO3)10(OH)3]}·5H2O	14:10	6685.09	monoclinic	C2/m	a = 29.724, b = 24.623, c = 20.687, β = 126.760°, Z = 2	12130	1.830	red	[8]
Tris(4-pyridyl)triazine zinc phosphate–phosphite	C54H60N18O42P10Zn9	?	2531.23	hexagonal	P63	a = 15.6464, c = 19.788, Z = 2	4195.2		yellow	[9]
1-(2-Aminoethyl)piperazine tetrazinc diphosphate diphosphite	(C6H17N3)[Zn4(PO4)2(HPO3)2]	2:2		monoclinic	Cc	a = 5.327, b = 17.146, c = 22.071, β = 94.58°, Z = 4	2009.5			[10]
Zinc phosphate-phosphite	trans-(C6H15N2)2Zn4(PO4)2(HPO3)2	2:2	841.78	monoclinic	P21/n	a = 9.706, b = 9.993, c = 27.557, β = 96.795°, Z = 4	2654.0	2.107		[11]
1,3-Cyclohexanebis(methylamine)	[H2CHBMA][Zn1.5Mn(HPO3)2.5(PO4)]·5H2O	1:5		monoclinic	C2/c	a = 33.929, b = 13.045, c = 8.971, β = 104.37°, Z = 2	3846.5			[12]
2-Hydroxypropylammonium dizinc hydrogenphosphite phosphate	[C3H6(OH)NH3][Zn2(HPO3)(PO4)]	1:1		triclinic	P1	a = 5.302, b = 8.934, c = 12.686, α = 74.35°, β = 88.54°, γ = 73.94°				[13]
(Bis(Cyclohexane-1,3-bis(methylammonium)) bis(μ4-phosphato)-tetrakis(μ3-hydrogen phosphito)-manganese-tetra-zinc dihydrate)	[H2CHBMA][Zn2Mn0.5(PO4)(HPO3)2]·H2O	1:2		monoclinic	C2/c	a = 33.929, b = 13.045, c = 8.971, β = 104.37°, Z = 4	3846			[14]
Triethylenetetramine	[C6N4H22]0.5[Zn3(PO4)2(HPO3)]	2:1								[15]
Zinc potassium phosphite phosphate										[16]
N,N,N′,N′-tetramethylenediamine (TMEDA)	(C6N2H18)2(C6N2H17)Ga15(OH)8(PO4)2(HPO4)12(HPO3)6·2H2O	14:6			P3	a = 19.046, c = 8.331, Z = 1	2617.1			[17]
Zirconium phosphate phosphite	γ-ZrPO4·HPO2(OH)·2H2O	1:1							layered	[18]
Cadmium 1,10-phenanthroline phosphate phosphite oxalate	Cd2(phen)2(H2PO4)(H2PO3)(C2O4)	1:1							chains	[19]
catena-(Tris(hexane-1,6-diaminium) octakis(μ3-phosphonato)-hexakis(μ3-phosphato)-tris(μ2-hydrogen phosphato)hexaaqua-nonaindium	[In9(H2O)6(HPO3)13(H2PO3)2(PO4)(HPO4)][(C6N2H18)3]	2:15		hexagonal	P63/m	a = 13.7676, c = 28.062				[20]
4-Bipyridine	(C10H10N2)1.5(H3O)3[In18(H2O)12(HPO4)12(HPO3)16(H2PO3)6]	12:16		hexagonal	P63/m	a = 13.784, c = 28.058	4617			[21]
catena-(Bis(propane-1,3-diammonium)-octakis(μ3-phosphito)-pentakis(μ2-hydrogen phosphito)-(μ2-dihydrogenphosphato)-hexaindium)	[In6(HPO3)8(H2PO3)5(H2PO4)]·(C3N2H12)2	1:11		orthorhombic	Pna21	a = 26.7974, b = 9.8459, c = 18.5441, Z = 4	4892.8			[22]
	Pb2Al(HPO3)3(H2PO4)	1:3		orthorhombic	Cmcm					[23]
	Pb2Ga(HPO3)3(H2PO4)	1:3		orthorhombic	Cmcm
	Pb2Al(HPO3)2(HPO4)(H2PO4)	2:2		orthorhombic	Cmcm
Rubidium uranium(VI,IV) phosphate-phosphite	Rb2[(UO2)2(UIV)(PO4)2(HPO3)2(H2O)]	2:2	1316.94	monoclinic	C2/c	a = 16.2421, b = 10.5049, c = 11.0936, β = 98.745°	1870.8	4.702	orange-yellow	[24]
Caesium uranium(IV) phosphate-phosphite	Cs2[UIV 3(PO4)2(HPO3)4]	2:4	1489.76	monoclinic	C2/m	a = 25.7396 b = 5.5906, c = 7.6334, β = 98.964°, Z = 2	1085.03	4.560	blue-green	[24]
Caesium uranium(VI,IV) phosphate-phosphite	Cs2[(UO2)(UIV)(HPO4)2(HPO3)2]	2:2	1123.78	triclinic	P1	a = 6.8571, b = 11.1190, c = 12.0391, α = 63.861°, β = 77.481°, γ = 79.331°, Z = 2	800.22	4.664	yellow-orange	[24]
	Cs4[(UO2)8(HPO4)5(HPO3)5]·4H2O	5:5		monoclinic	C2/c	a = 18.5005, b = 10.971, c = 14.4752, β = 104.513°			yellow	[25]
	Cs4[UIV 6(PO4)8(HPO4)(HPO3)]	9:1		orthorhombic	Pmmn	a = 6.9321, b = 26.935, c = 10.9137			pale green	[25]
	Cs10[UIV 10(PO4)4(HPO4)14(HPO3)5]·H2O	15:5		monoclinic	C2/m	a = 19.2966, b = 20.2914, c = 13.9293, β = 126.839°			green	[25]
	Tl3[(UO2)2(H1.5PO4)(H0.5PO4)(H1.5PO3)2]	2:2	1503.07	tetragonal	P42/mbc	a = 13.5382, c = 19.4008, Z = 8	3555.8	5.615	yellow-green	[26]
	Tl2[(UO2)2(UIV)(H2O)(PO4)2(HPO3)2]	2:2	1550.71	monoclinic	C2/c	a = 16.2360, b = 10.4995, c = 11.0003, β = 99.027°, Z = 4	1851.99	5.562	light green	[26]