| name |
formula |
ratio PO4:PO3 |
mw |
system |
space group |
unit cell (Å) |
volume |
density |
properties |
references |
| 1,4-Diammoniumbutane |
[(H3N(CH2)4NH3)2][Sc5F4(HPO3)6(H2PO3)2(PO4)] |
1:8 |
1300.8 |
monoclinic |
C2/m |
a = 12.888, b = 14.835, c = 10.531, β = 103.093°, Z = 2 (at 93 K) |
1961.2 |
|
|
[2] |
| Imidazole |
[C3N2H5]2[VIII 4(H2O)3(HPO3)4(HPO4)3] |
3:4 |
1003.766 |
trigonal |
P3c1 |
a = 13.499, c = 18.120, Z = 12 |
2280.35 |
2.143 |
green |
[3] |
|
(C3H10NO)6[V8(H2O)6(PO4)2(HPO3)12] |
2:12 |
|
|
P3c1 |
a = 13.5393, c = 18.2283 |
2893.8 |
|
green |
[4] |
|
(C4H8N2)3[V8(H2O)6(PO4)2(HPO3)12] |
2:12 |
|
|
P3c1 |
a = 13.4922, c = 18.3589 |
2894.3 |
|
green |
[4] |
|
Mn5(μ-OH2)2(PO4)2(HPO3)2·2H2O |
2:2 |
|
|
|
|
|
|
|
[5] |
| Iron(III) 2,2′-bipyridine phosphite−phposphate |
[FeIII(2,2′-bipyridine)(HPO3)(H2PO4)] |
1:1 |
|
monoclinic |
|
a = 10.5407, b = 6.4298, c = 10.6172, β = 113.890°, Z = 2 |
|
1.878 |
colourless |
[6] |
|
FeIII(1,10-phenanthroline)(HPO3)(H2PO3) |
1:1 |
|
monoclinic |
P21/m |
a = 10.180, b = 6.424, c = 11.6668, β = 115.59°, Z = 4 |
668.2 |
1.880 |
yellow |
[7] |
|
{[C3H4N2]2[C5NH5]14[H15(Mo2O4)8Co16(PO4)14(HPO3)10(OH)3]}·5H2O |
14:10 |
6685.09 |
monoclinic |
C2/m |
a = 29.724, b = 24.623, c = 20.687, β = 126.760°, Z = 2 |
12130 |
1.830 |
red |
[8] |
| Tris(4-pyridyl)triazine zinc phosphate–phosphite |
C54H60N18O42P10Zn9 |
? |
2531.23 |
hexagonal |
P63 |
a = 15.6464, c = 19.788, Z = 2 |
4195.2 |
|
yellow |
[9] |
| 1-(2-Aminoethyl)piperazine tetrazinc diphosphate diphosphite |
(C6H17N3)[Zn4(PO4)2(HPO3)2] |
2:2 |
|
monoclinic |
Cc |
a = 5.327, b = 17.146, c = 22.071, β = 94.58°, Z = 4 |
2009.5 |
|
|
[10] |
| Zinc phosphate-phosphite |
trans-(C6H15N2)2Zn4(PO4)2(HPO3)2 |
2:2 |
841.78 |
monoclinic |
P21/n |
a = 9.706, b = 9.993, c = 27.557, β = 96.795°, Z = 4 |
2654.0 |
2.107 |
|
[11] |
| 1,3-Cyclohexanebis(methylamine) |
[H2CHBMA][Zn1.5Mn(HPO3)2.5(PO4)]·5H2O |
1:5 |
|
monoclinic |
C2/c |
a = 33.929, b = 13.045, c = 8.971, β = 104.37°, Z = 2 |
3846.5 |
|
|
[12] |
| 2-Hydroxypropylammonium dizinc hydrogenphosphite phosphate |
[C3H6(OH)NH3][Zn2(HPO3)(PO4)] |
1:1 |
|
triclinic |
P1 |
a = 5.302, b = 8.934, c = 12.686, α = 74.35°, β = 88.54°, γ = 73.94° |
|
|
|
[13] |
|
(Bis(Cyclohexane-1,3-bis(methylammonium)) bis(μ4-phosphato)-tetrakis(μ3-hydrogen phosphito)-manganese-tetra-zinc dihydrate) |
[H2CHBMA][Zn2Mn0.5(PO4)(HPO3)2]·H2O |
1:2 |
|
monoclinic |
C2/c |
a = 33.929, b = 13.045, c = 8.971, β = 104.37°, Z = 4 |
3846 |
|
|
[14] |
| Triethylenetetramine |
[C6N4H22]0.5[Zn3(PO4)2(HPO3)] |
2:1 |
|
|
|
|
|
|
|
[15] |
| Zinc potassium phosphite phosphate |
|
|
|
|
|
|
|
|
|
[16] |
| N,N,N′,N′-tetramethylenediamine (TMEDA) |
(C6N2H18)2(C6N2H17)Ga15(OH)8(PO4)2(HPO4)12(HPO3)6·2H2O |
14:6 |
|
|
P3 |
a = 19.046, c = 8.331, Z = 1 |
2617.1 |
|
|
[17] |
| Zirconium phosphate phosphite |
γ-ZrPO4·HPO2(OH)·2H2O |
1:1 |
|
|
|
|
|
|
layered |
[18] |
| Cadmium 1,10-phenanthroline phosphate phosphite oxalate |
Cd2(phen)2(H2PO4)(H2PO3)(C2O4) |
1:1 |
|
|
|
|
|
|
chains |
[19] |
| catena-(Tris(hexane-1,6-diaminium) octakis(μ3-phosphonato)-hexakis(μ3-phosphato)-tris(μ2-hydrogen phosphato)hexaaqua-nonaindium |
[In9(H2O)6(HPO3)13(H2PO3)2(PO4)(HPO4)][(C6N2H18)3] |
2:15 |
|
hexagonal |
P63/m |
a = 13.7676, c = 28.062 |
|
|
|
[20] |
| 4-Bipyridine |
(C10H10N2)1.5(H3O)3[In18(H2O)12(HPO4)12(HPO3)16(H2PO3)6] |
12:16 |
|
hexagonal |
P63/m |
a = 13.784, c = 28.058 |
4617 |
|
|
[21] |
| catena-(Bis(propane-1,3-diammonium)-octakis(μ3-phosphito)-pentakis(μ2-hydrogen phosphito)-(μ2-dihydrogenphosphato)-hexaindium) |
[In6(HPO3)8(H2PO3)5(H2PO4)]·(C3N2H12)2 |
1:11 |
|
orthorhombic |
Pna21 |
a = 26.7974, b = 9.8459, c = 18.5441, Z = 4 |
4892.8 |
|
|
[22] |
|
Pb2Al(HPO3)3(H2PO4) |
1:3 |
|
orthorhombic |
Cmcm |
|
|
|
|
[23] |
|
Pb2Ga(HPO3)3(H2PO4) |
1:3 |
|
orthorhombic |
Cmcm |
|
|
|
|
|
|
Pb2Al(HPO3)2(HPO4)(H2PO4) |
2:2 |
|
orthorhombic |
Cmcm |
|
|
|
|
|
| Rubidium uranium(VI,IV) phosphate-phosphite |
Rb2[(UO2)2(UIV)(PO4)2(HPO3)2(H2O)] |
2:2 |
1316.94 |
monoclinic |
C2/c |
a = 16.2421, b = 10.5049, c = 11.0936, β = 98.745° |
1870.8 |
4.702 |
orange-yellow |
[24] |
| Caesium uranium(IV) phosphate-phosphite |
Cs2[UIV 3(PO4)2(HPO3)4] |
2:4 |
1489.76 |
monoclinic |
C2/m |
a = 25.7396 b = 5.5906, c = 7.6334, β = 98.964°, Z = 2 |
1085.03 |
4.560 |
blue-green |
[24] |
| Caesium uranium(VI,IV) phosphate-phosphite |
Cs2[(UO2)(UIV)(HPO4)2(HPO3)2] |
2:2 |
1123.78 |
triclinic |
P1 |
a = 6.8571, b = 11.1190, c = 12.0391, α = 63.861°, β = 77.481°, γ = 79.331°, Z = 2 |
800.22 |
4.664 |
yellow-orange |
[24] |
|
Cs4[(UO2)8(HPO4)5(HPO3)5]·4H2O |
5:5 |
|
monoclinic |
C2/c |
a = 18.5005, b = 10.971, c = 14.4752, β = 104.513° |
|
|
yellow |
[25] |
|
Cs4[UIV 6(PO4)8(HPO4)(HPO3)] |
9:1 |
|
orthorhombic |
Pmmn |
a = 6.9321, b = 26.935, c = 10.9137 |
|
|
pale green |
[25] |
|
Cs10[UIV 10(PO4)4(HPO4)14(HPO3)5]·H2O |
15:5 |
|
monoclinic |
C2/m |
a = 19.2966, b = 20.2914, c = 13.9293, β = 126.839° |
|
|
green |
[25] |
|
Tl3[(UO2)2(H1.5PO4)(H0.5PO4)(H1.5PO3)2] |
2:2 |
1503.07 |
tetragonal |
P42/mbc |
a = 13.5382, c = 19.4008, Z = 8 |
3555.8 |
5.615 |
yellow-green |
[26] |
|
Tl2[(UO2)2(UIV)(H2O)(PO4)2(HPO3)2] |
2:2 |
1550.71 |
monoclinic |
C2/c |
a = 16.2360, b = 10.4995, c = 11.0003, β = 99.027°, Z = 4 |
1851.99 |
5.562 |
light green |
[26] |