Pigment yellow 185 is an organic compound that is used as a green yellow pigment and optical brightener. It is classified as a derivative of isoindoline. This yellow green compound is prepared by addition of ammonia to phthalonitrile to give diiminoisoindole, which in turn condenses first with N-methylcyanoacetamide and then with barbituric acid.[1]
Quick facts Names, Identifiers ...
Pigment yellow 185
 |
| Names |
Preferred IUPAC name
(2Z)-2-Cyano-N-methyl-2-[3-(2,4,6-trioxo-1,3-diazinan-5-ylidene)-2,3-dihydro-1H-isoindol-1-ylidene]acetamide |
Other names
- Isoindolinone Yellow AS-AP
- Isoindolinone Yellow AS-BH
- Isoindolinone Yellow ASR-AG
- Enceprint Yellow
- Sico Fast Yellow D
|
| Identifiers |
|
|
|
|
| ChemSpider |
|
| ECHA InfoCard |
100.071.241 |
| EC Number |
|
|
|
| UNII |
|
|
|
InChI=1S/C16H11N5O4/c1-18-13(22)9(6-17)11-7-4-2-3-5-8(7)12(19-11)10-14(23)20-16(25)21-15(10)24/h2-5,19H,1H3,(H,18,22)(H2,20,21,23,24,25)/b11-9- Key: ACUPDOXCXXCPIX-LUAWRHEFSA-N
|
CNC(=O)/C(C#N)=C1/c2ccccc2C(N1)=C3C(=O)NC(=O)NC3=O
|
| Properties |
|
C16H11N5O4 |
| Molar mass |
337.295 g·mol−1 |
| Appearance |
yellow green solid |
| Density |
1.576 g/cm3 |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). |
Close
