Pindone is an organic compound. A derivative of 1,3-indandione, it is used as a rodenticide.[3] Its mode of action is as a anticoagulant.[4] for agricultural use. It is commonly used as a rodenticide in the management of rat and rabbit populations.
Quick facts Names, Identifiers ...
Pindone
 |
| Names |
Preferred IUPAC name
2-(2,2-Dimethylpropanoyl)-1H-indene-1,3(2H)-dione |
| Other names
2-Pivaloyl-1,3-indandione |
| Identifiers |
|
|
|
|
| ChemSpider |
|
| ECHA InfoCard |
100.001.330 |
| KEGG |
|
|
|
| UNII |
|
|
|
InChI=1S/C14H14O3/c1-14(2,3)13(17)10-11(15)8-6-4-5-7-9(8)12(10)16/h4-7,10H,1-3H3 Y Key: RZKYEQDPDZUERB-UHFFFAOYSA-N Y InChI=1/C14H14O3/c1-14(2,3)13(17)10-11(15)8-6-4-5-7-9(8)12(10)16/h4-7,10H,1-3H3 Key: RZKYEQDPDZUERB-UHFFFAOYAX
|
O=C2c1ccccc1C(=O)C2C(=O)C(C)(C)C
|
| Properties |
|
C14H14O3 |
| Molar mass |
230.26 g/mol |
| Appearance |
Bright-yellow powder[1] |
| Odor |
almost none |
| Density |
1.06 g/mL |
| Melting point |
110 °C (230 °F; 383 K) |
|
0.002% (25°C)[1] |
| Hazards |
| Lethal dose or concentration (LD, LC): |
|
280 mg/kg (rat, oral) 75 mg/kg (dog, oral) 150 mg/kg (rabbit, oral)[2] |
| NIOSH (US health exposure limits): |
|
TWA 0.1 mg/m3[1] |
|
TWA 0.1 mg/m3[1] |
|
100 mg/m3[1] |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
Close
It is pharmacologically analogous to warfarin and inhibits the synthesis of vitamin K-dependent clotting factors.