Platinum(II) bis(acetylacetonate) is the coordination compound with the formula Pt(O2C5H7)2, abbreviated Pt(acac)2. The homoleptic acetylacetonate complex of platinum(II), it is a yellow, benzene-soluble solid. According to X-ray crystallography, the Pt center is square planar.[2] The compound is a widely used precursor to platinum-based catalysts.[3]
Packing of Pt(acac)2 molecules within a crystal.
Quick facts Names, Identifiers ...
Platinum(II) bis(acetylacetonate)
 |
 |
 |
| Names |
| Other names
Bis(2,4-pentanedionato)platinum; Platinum bis(acetylacetonate); Bis(acetylacetonato)platinum |
| Identifiers |
|
|
|
|
| ChemSpider |
|
| ECHA InfoCard |
100.035.642 |
| EC Number |
|
|
|
InChI=1S/2C5H8O2.Pt/c2*1-4(6)3-5(2)7;/h2*3,6H,1-2H3;/b2*4-3-; Key: VEJOYRPGKZZTJW-FDGPNNRMSA-N
|
coordination form: CC(=C[C-](C)O1)O[Pt+2]12OC(=C[C-](C)O2)C ionic form: O=C(C)/C=C(C)\[O-].O=C(C)/C=C(C)\[O-].[Pt+2]
|
| Properties |
|
C10H14O4Pt |
| Molar mass |
393.302 g·mol−1 |
| Appearance |
yellow solid |
| Density |
2.362 g/cm3 |
| Melting point |
239.4 C (dec.)[1] |
|
insoluble |
| Hazards |
| GHS labelling: |
|
  |
|
Warning |
|
H302, H312, H315, H319, H332, H335, H361 |
|
P201, P202, P261, P264, P270, P271, P280, P281, P301+P312, P302+P352, P304+P312, P304+P340, P305+P351+P338, P308+P313, P312, P321, P322, P330, P332+P313, P337+P313, P362, P363, P403+P233, P405, P501 |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). |
Close
The complex is prepared by the reaction of the platinum(II) aquo complex [Pt(H2O)4]2+ with acetylacetone.[4]
2.svg)
2.jpg)
