RF9 (drug)

RF9 is a drug used in scientific research which acts as a potent and selective antagonist for the neuropeptide FF receptors NPFF1 and NPFF2, binding to both NPFF subtypes but with improved selectivity over related targets such as neuropeptide Y receptors compared to older drugs such as BIBP-3226. In animal studies, RF9 increased the analgesic effects of mu-opioid agonists while decreasing some side effects such as hyperalgesia.^{[1][2][3][4][5][6]}

RF9 (drug)

Identifiers
IUPAC name (1S,3S,5S,7S)-N-((S)-1-(((S)-1-Amino-1-oxo-3-phenylpropan-2-yl)amino)-5-guanidino-1-oxopentan-2-yl)adamantane-2-carboxamide
CAS Number	876310-60-0
PubChem CID	53320361
ChemSpider	9866263
ChEBI	CHEBI:140980
ChEMBL	ChEMBL1672380
CompTox Dashboard (EPA)	DTXSID001151466
Chemical and physical data
Formula	C26H38N6O3
Molar mass	482.629 g·mol−1
3D model (JSmol)	Interactive image
SMILES O=C(N[C@H]([C@](N[C@H](C(N)=O)CC4=CC=CC=C4)=O)CCCNC(N)=N)C1(CC(C3)C2)CC3CC2C1
InChI InChI=1S/C26H38N6O3/c27-23(33)21(14-15-5-2-1-3-6-15)32-24(34)20(7-4-8-30-26(28)29)31-25(35)22-18-10-16-9-17(12-18)13-19(22)11-16/h1-3,5-6,16-22H,4,7-14H2,(H2,27,33)(H,31,35)(H,32,34)(H4,28,29,30)/t16?,17?,18?,19?,20-,21-,22?/m0/s1 Key:ZLSDDXOZWMSRNZ-BFLAJNRSSA-N