Ranelic acid is an organic acid capable of chelating metal cations.[2]
Quick facts Names, Identifiers ...
Ranelic acid
 Structural formula of ranelic acid |
 |
| Names |
| IUPAC name
3-(Carboxymethyl)-5-[N-(carboxymethyl)glycino]-4-cyanothiophene-2-carboxylic acid |
Systematic IUPAC name
5-[Bis(carboxymethyl)amino]-3-(carboxymethyl)-4-cyanothiophene-2-carboxylic acid [1] |
| Identifiers |
|
|
|
|
| ChemSpider |
|
| KEGG |
|
|
|
| UNII |
|
|
|
InChI=1S/C12H10N2O8S/c13-2-6-5(1-7(15)16)10(12(21)22)23-11(6)14(3-8(17)18)4-9(19)20/h1,3-4H2,(H,15,16)(H,17,18)(H,19,20)(H,21,22) Y Key: DJSXNILVACEBLP-UHFFFAOYSA-N Y
|
OC(=O)CN(CC(O)=O)C1=C(C#N)C(CC(O)=O)=C(S1)C(O)=O C(C1=C(SC(=C1C#N)N(CC(=O)O)CC(=O)O)C(=O)O)C(=O)O
|
| Properties |
|
C12H10N2O8S |
| Molar mass |
342.28 g·mol−1 |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). |
Close
It forms the ranelate ion, C12H6N2O8S4−. Strontium ranelate, the strontium salt of ranelic acid, is a drug used to treat osteoporosis and increase bone mineral density (BMD).
