Retronecine is a pyrrolizidine alkaloid found in a variety of plants in the genera Senecio and Crotalaria, and the family Boraginaceae. It is the most common central core for other pyrrolizidine alkaloids.[1]
Quick facts Names, Identifiers ...
Retronecine
 |
 |
| Names |
Preferred IUPAC name
(1R,7aR)-7-(Hydroxymethyl)-2,3,5,7a-tetrahydro-1H-pyrrolizin-1-ol |
| Other names
(+)-Retronecine; Retronecin; Senecifolinene |
| Identifiers |
|
|
|
|
| ChemSpider |
|
|
|
| UNII |
|
|
|
InChI=1S/C8H13NO2/c10-5-6-1-3-9-4-2-7(11)8(6)9/h1,7-8,10-11H,2-5H2/t7-,8-/m1/s1 Key: HJSJELVDQOXCHO-HTQZYQBOSA-N InChI=1/C8H13NO2/c10-5-6-1-3-9-4-2-7(11)8(6)9/h1,7-8,10-11H,2-5H2/t7-,8-/m1/s1 Key: HJSJELVDQOXCHO-HTQZYQBOBU
|
C1CN2CC=C([C@@H]2[C@@H]1O)CO
|
| Properties |
|
C8H13NO2 |
| Molar mass |
155.197 g·mol−1 |
| Melting point |
119 to 120 °C (246 to 248 °F; 392 to 393 K)[1] |
| Hazards |
| Lethal dose or concentration (LD, LC): |
|
634 mg/kg (IV, mouse)[1] |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). |
Close
