Rotundone is a sesquiterpene originally discovered in the tubers of Java grass (Cyperus rotundus). Rotundone is also present in the essential oils of black pepper, marjoram, oregano, rosemary, basil, thyme, and geranium, as well as in some Syrah wines.[1][2] It imparts a peppery aroma.[3]
Quick facts Names, Identifiers ...
Rotundone
 |
| Names |
| IUPAC name
Guaia-1(5),11-dien-2-one |
Systematic IUPAC name
(3S,5R,8S)-3,8-Dimethyl-5-(prop-1-en-2-yl)-3,4,5,6,7,8-hexahydroazulen-1(2H)-one |
| Identifiers |
|
|
|
|
| ChemSpider |
|
|
|
| UNII |
|
|
|
InChI=1S/C15H22O/c1-9(2)12-6-5-10(3)15-13(8-12)11(4)7-14(15)16/h10-12H,1,5-8H2,2-4H3/t10-,11-,12+/m0/s1 Key: NUWMTBMCSQWPDG-SDDRHHMPSA-N InChI=1/C15H22O/c1-9(2)12-6-5-10(3)15-13(8-12)11(4)7-14(15)16/h10-12H,1,5-8H2,2-4H3/t10-,11-,12+/m0/s1 Key: NUWMTBMCSQWPDG-SDDRHHMPBR
|
O=C1\C2=C(/[C@H](C1)C)C[C@H](\C(=C)C)CC[C@@H]2C
|
| Properties |
|
C15H22O |
| Molar mass |
218.340 g·mol−1 |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). |
Close
