Sorbitan monolaurate is a mixture of esters formed from the fatty acid lauric acid and polyols derived from sorbitol, including sorbitan and isosorbide.[2] As a food additive, it is designated with the E number E493.
Quick Facts Names, Identifiers ...
Sorbitan monolaurate
 Major chemical component of sorbitan monolaurate |
Names |
Systematic IUPAC name
(2Ξ)-2-[(2R,3R,4S)-3,4-Dihydroxyoxolan-2-yl]-2-hydroxyethyl dodecanoate |
Other names
- Dodecanoic acid [2-[(2R,3R,4S)-3,4-dihydroxy-2-tetrahydrofuranyl]-2-hydroxyethyl] ester
- alkamuls s 20
- glycomul lC
- sorbitan laurate
- Span 20
- E493
|
Identifiers |
|
|
|
|
|
8355657 |
ChemSpider |
|
ECHA InfoCard |
100.014.240 |
E number |
E493 (thickeners, ...) |
|
|
RTECS number |
|
UNII |
|
|
|
InChI=1/C18H34O6/c1-2-3-4-5-6-7-8-9-10-11-16(21)23-13-15(20)18-17(22)14(19)12-24-18/h14-15,17-20,22H,2-13H2,1H3/t14-,15?,17+,18+/m0/s1 Key: LWZFANDGMFTDAV-WYDSMHRWSA-N
|
Span 20: CCCCCCCCCCCC(=O)OCC(C1C(C(CO1)O)O)O
|
Properties |
|
C18H34O6 |
Molar mass |
346.464 g·mol−1 |
Density |
1.032 g/cm3[1] |
|
insoluble |
Hazards |
Flash point |
110 °C (230 °F; 383 K) |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
Close