(−)-Stepholidine is a protoberberine alkaloid found in the plant Stephania intermedia.
Quick facts Names, Identifiers ...
(−)-Stepholidine
 |
Names |
IUPAC name
3,9-Dimethoxyberbine-2,10-diol |
Systematic IUPAC name
(13aS)-3,9-Dimethoxy-5,8,13,13a-tetrahydro-6H-isoquinolino[3,2-a]isoquinoline-2,10-diol |
Other names
l-Stepholidine |
Identifiers |
|
|
|
|
ChEMBL |
|
ChemSpider |
|
MeSH |
Stepholidine |
|
|
UNII |
|
|
|
InChI=1S/C19H21NO4/c1-23-18-8-12-5-6-20-10-14-11(3-4-16(21)19(14)24-2)7-15(20)13(12)9-17(18)22/h3-4,8-9,15,21-22H,5-7,10H2,1-2H3/t15-/m0/s1 N Key: JKPISQIIWUONPB-HNNXBMFYSA-N N InChI=1/C19H21NO4/c1-23-18-8-12-5-6-20-10-14-11(3-4-16(21)19(14)24-2)7-15(20)13(12)9-17(18)22/h3-4,8-9,15,21-22H,5-7,10H2,1-2H3/t15-/m0/s1 Key: JKPISQIIWUONPB-HNNXBMFYBD
|
COC1=C(C=C2[C@@H]3CC4=C(CN3CCC2=C1)C(=C(C=C4)O)OC)O
|
Properties |
|
C19H21NO4 |
Molar mass |
327.374 g/mol |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
Close
Stepholidine activity includes dual D2 receptor antagonist and D1 receptor agonist, and has shown antipsychotic activity in animal studies.[1][2][3][4]