Stigmastanol (sitostanol) is a phytosterol found in a variety of plant sources. Similar to sterol esters and stanol esters, stigmastanol inhibits the absorption of cholesterol from the diet.[2][3][4] Animal studies suggest that it also inhibits biosynthesis of cholesterol in the liver.[2][verification needed]
Quick facts Names, Identifiers ...
Stigmastanol
 |
| Names |
| IUPAC name
5α-Stigmastan-3β-ol |
Systematic IUPAC name
(1R,3aS,3bR,5aS,7S,9aS,9bS,11aR)-1-[(2R,5R)-5-Ethyl-6-methylheptan-2-yl]-9a,11a-dimethylhexadecahydro-1H-cyclopenta[a]phenanthren-7-ol |
| Other names
(3β)-Stigmastan-3-ol; (3β,5α)-Stigmastan-3-ol; β-Sitostanol; Dihydrositosterin; Dihydrositosterol; Dihydro-β-sitosterol; Fucostanol; Spinastanol; 24α-Ethylcholestanol |
| Identifiers |
|
|
|
|
| ChEBI |
|
| ChEMBL |
|
| ChemSpider |
|
| ECHA InfoCard |
100.001.345 |
|
|
| UNII |
|
|
|
InChI=1S/C29H52O/c1-7-21(19(2)3)9-8-20(4)25-12-13-26-24-11-10-22-18-23(30)14-16-28(22,5)27(24)15-17-29(25,26)6/h19-27,30H,7-18H2,1-6H3/t20-,21-,22?,23+,24+,25-,26+,27+,28+,29-/m1/s1 Key: LGJMUZUPVCAVPU-KZXGMYDKSA-N
|
O[C@H]1CC[C@@]2(C)[C@](CC[C@]3([H])[C@]2([H])CC[C@@]4(C)[C@@]3([H])CC[C@]4([H])[C@@H](CC[C@@H](CC)C(C)C)C)([H])C1
|
| Properties |
|
C29H52O |
| Molar mass |
416.734 g·mol−1 |
| Boiling point |
139.4 to 139.8 °C (282.9 to 283.6 °F; 412.5 to 412.9 K)[1] |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). |
Close
Stigmastanol is the product of the reduction of β-sitosterol[5] and the hydrogenation of stigmasterol.[6]
