Strictamine is an alkaloid isolated from Alstonia scholaris.[1]
Quick Facts Names, Identifiers ...
Strictamine
 |
Names |
IUPAC name
methyl (10S,12R,13E,18S)-13-Ethylidene-8,15-diazapentacyclo[10.5.1.01,9.02,7.010,15]octadeca-2,4,6,8-tetraene-18-carboxylate |
Other names
Desacetyldesformoakuammiline; Vincamidine |
Identifiers |
|
|
|
|
ChemSpider |
|
|
|
InChI=1S/C20H22N2O2/c1-3-12-11-22-9-8-20-14-6-4-5-7-15(14)21-18(20)16(22)10-13(12)17(20)19(23)24-2/h3-7,13,16-17H,8-11H2,1-2H3/b12-3-/t13-,16-,17+,20?/m0/s1 Key: LITYYRLWHAQJQS-PHDDPKRUSA-N
|
C/C=C\1/CN2CCC34[C@H]([C@H]1C[C@H]2C3=NC5=CC=CC=C45)C(=O)OC
|
Properties |
|
C20H22N2O2 |
Molar mass |
322.408 g·mol−1 |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
Close
Because of its unusual chemical structure, it has attracted research interest and several laboratory syntheses have been reported.[2][3][4][5]